C14H19ClO — CID 153145267
1-(3-chlorophenyl)-2-deuterio-2,4,4-trimethylpentan-1-one (PubChem CID 153145267) has the molecular formula C14H19ClO and a molecular weight of 239.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-deuterio-2,4,4-trimethylpentan-1-one.
| Compound Name | 1-(3-chlorophenyl)-2-deuterio-2,4,4-trimethylpentan-1-one |
|---|---|
| PubChem CID | 153145267 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 239.76 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1-(3-chlorophenyl)-2-deuterio-2,4,4-trimethylpentan-1-one |
| SMILES | [2H]C(C)(CC(C)(C)C)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H19ClO/c1-10(9-14(2,3)4)13(16)11-6-5-7-12(15)8-11/h5-8,10H,9H2,1-4H3/i10D |
| InChIKey | VZKMCHVXXYWDCW-MMIHMFRQSA-N |
| XLogP | 4.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.76 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |