C14H21Cl2NO — CID 3031068
1-(3-chlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-one;hydrochloride (PubChem CID 3031068) has the molecular formula C14H21Cl2NO and a molecular weight of 290.23 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-one;hydrochloride.
| Compound Name | 1-(3-chlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 3031068 |
| Molecular Formula | C14H21Cl2NO |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(2-methylbutan-2-ylamino)propan-1-one;hydrochloride |
| SMILES | CCC(C)(C)NC(C)C(=O)c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C14H20ClNO.ClH/c1-5-14(3,4)16-10(2)13(17)11-7-6-8-12(15)9-11;/h6-10,16H,5H2,1-4H3;1H |
| InChIKey | USMRGUICWFYEDW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |