C33H41ClN2O — CID 70283144
2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one;N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine (PubChem CID 70283144) has the molecular formula C33H41ClN2O and a molecular weight of 517.16 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one;N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine.
| Compound Name | 2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one;N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine |
|---|---|
| PubChem CID | 70283144 |
| Molecular Formula | C33H41ClN2O |
| Molecular Weight | 517.16 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one;N,N-dimethyl-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine |
| SMILES | CC(NC(C)(C)C)C(=O)c1cccc(Cl)c1.CN(C)CCC=C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C20H23N.C13H18ClNO/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10/h3-6,8-12H,7,13-15H2,1-2H3;5-9,15H,1-4H3 |
| InChIKey | PRBWXKKHOFGNSX-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.16 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|