C26H25ClN2S — CID 5147018
3-(4-chlorophenyl)-1-methyl-1-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]thiourea (PubChem CID 5147018) has the molecular formula C26H25ClN2S and a molecular weight of 433.02 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-methyl-1-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]thiourea.
| Compound Name | 3-(4-chlorophenyl)-1-methyl-1-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]thiourea |
|---|---|
| PubChem CID | 5147018 |
| Molecular Formula | C26H25ClN2S |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 3-(4-chlorophenyl)-1-methyl-1-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]thiourea |
| SMILES | CN(CCC=C1c2ccccc2CCc2ccccc21)C(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H25ClN2S/c1-29(26(30)28-22-16-14-21(27)15-17-22)18-6-11-25-23-9-4-2-7-19(23)12-13-20-8-3-5-10-24(20)25/h2-5,7-11,14-17H,6,12-13,18H2,1H3,(H,28,30) |
| InChIKey | FKWOZGMESDBYJO-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|