C23H29N2O+ — CID 59364535
[4-[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]amino]-4-oxobutyl]azanium (PubChem CID 59364535) has the molecular formula C23H29N2O+ and a molecular weight of 349.50 g/mol. Its IUPAC name is [4-[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]amino]-4-oxobutyl]azanium.
| Compound Name | [4-[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]amino]-4-oxobutyl]azanium |
|---|---|
| PubChem CID | 59364535 |
| Molecular Formula | C23H29N2O+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | [4-[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]amino]-4-oxobutyl]azanium |
| SMILES | CN(CCC=C1c2ccccc2CCc2ccccc21)C(=O)CCC[NH3+] |
| InChI | InChI=1S/C23H28N2O/c1-25(23(26)13-6-16-24)17-7-12-22-20-10-4-2-8-18(20)14-15-19-9-3-5-11-21(19)22/h2-5,8-12H,6-7,13-17,24H2,1H3/p+1 |
| InChIKey | DOIAVGICIXNFIH-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 47.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|