C26H25BrN2O — CID 3779819
3-(3-bromophenyl)-1-methyl-1-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]urea (PubChem CID 3779819) has the molecular formula C26H25BrN2O and a molecular weight of 461.40 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1-methyl-1-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]urea.
| Compound Name | 3-(3-bromophenyl)-1-methyl-1-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]urea |
|---|---|
| PubChem CID | 3779819 |
| Molecular Formula | C26H25BrN2O |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 3-(3-bromophenyl)-1-methyl-1-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]urea |
| SMILES | CN(CCC=C1c2ccccc2CCc2ccccc21)C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C26H25BrN2O/c1-29(26(30)28-22-11-6-10-21(27)18-22)17-7-14-25-23-12-4-2-8-19(23)15-16-20-9-3-5-13-24(20)25/h2-6,8-14,18H,7,15-17H2,1H3,(H,28,30) |
| InChIKey | HYDUCCZSNLDITD-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|