C18H15BrN2O3 — CID 9191641
N-(3-bromophenyl)-3-(1,3-dioxo-4H-isoquinolin-2-yl)propanamide (PubChem CID 9191641) has the molecular formula C18H15BrN2O3 and a molecular weight of 387.23 g/mol. Its IUPAC name is N-(3-bromophenyl)-3-(1,3-dioxo-4H-isoquinolin-2-yl)propanamide.
| Compound Name | N-(3-bromophenyl)-3-(1,3-dioxo-4H-isoquinolin-2-yl)propanamide |
|---|---|
| PubChem CID | 9191641 |
| Molecular Formula | C18H15BrN2O3 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | N-(3-bromophenyl)-3-(1,3-dioxo-4H-isoquinolin-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)Cc2ccccc2C1=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C18H15BrN2O3/c19-13-5-3-6-14(11-13)20-16(22)8-9-21-17(23)10-12-4-1-2-7-15(12)18(21)24/h1-7,11H,8-10H2,(H,20,22) |
| InChIKey | FGWHTCDRJHLKSW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|