C19H17FN4O3S — CID 9317894
1-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoylamino]-3-(4-fluorophenyl)thiourea (PubChem CID 9317894) has the molecular formula C19H17FN4O3S and a molecular weight of 400.44 g/mol. Its IUPAC name is 1-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoylamino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoylamino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9317894 |
| Molecular Formula | C19H17FN4O3S |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 1-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoylamino]-3-(4-fluorophenyl)thiourea |
| SMILES | O=C(CCN1C(=O)Cc2ccccc2C1=O)NNC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN4O3S/c20-13-5-7-14(8-6-13)21-19(28)23-22-16(25)9-10-24-17(26)11-12-3-1-2-4-15(12)18(24)27/h1-8H,9-11H2,(H,22,25)(H2,21,23,28) |
| InChIKey | GCEOBJXOXMXZFI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|