C18H17N3O5 — CID 9326561
N'-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoyl]-2-methylfuran-3-carbohydrazide (PubChem CID 9326561) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is N'-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoyl]-2-methylfuran-3-carbohydrazide.
| Compound Name | N'-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoyl]-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 9326561 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N'-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoyl]-2-methylfuran-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)CCN1C(=O)Cc2ccccc2C1=O |
| InChI | InChI=1S/C18H17N3O5/c1-11-13(7-9-26-11)17(24)20-19-15(22)6-8-21-16(23)10-12-4-2-3-5-14(12)18(21)25/h2-5,7,9H,6,8,10H2,1H3,(H,19,22)(H,20,24) |
| InChIKey | JMTGPFPJYNSEKP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|