C19H16ClN3O5 — CID 9278553
5-chloro-N'-[2-(1,3-dioxo-4H-isoquinolin-2-yl)acetyl]-2-methoxybenzohydrazide (PubChem CID 9278553) has the molecular formula C19H16ClN3O5 and a molecular weight of 401.81 g/mol. Its IUPAC name is 5-chloro-N'-[2-(1,3-dioxo-4H-isoquinolin-2-yl)acetyl]-2-methoxybenzohydrazide.
| Compound Name | 5-chloro-N'-[2-(1,3-dioxo-4H-isoquinolin-2-yl)acetyl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 9278553 |
| Molecular Formula | C19H16ClN3O5 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 5-chloro-N'-[2-(1,3-dioxo-4H-isoquinolin-2-yl)acetyl]-2-methoxybenzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)CN1C(=O)Cc2ccccc2C1=O |
| InChI | InChI=1S/C19H16ClN3O5/c1-28-15-7-6-12(20)9-14(15)18(26)22-21-16(24)10-23-17(25)8-11-4-2-3-5-13(11)19(23)27/h2-7,9H,8,10H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | QTPFBRAIOMBWOD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|