C16H18ClN3O4S2 — CID 9472330
5-chloro-2-methoxy-N'-[5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanoyl]benzohydrazide (PubChem CID 9472330) has the molecular formula C16H18ClN3O4S2 and a molecular weight of 415.92 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N'-[5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanoyl]benzohydrazide.
| Compound Name | 5-chloro-2-methoxy-N'-[5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9472330 |
| Molecular Formula | C16H18ClN3O4S2 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 5-chloro-2-methoxy-N'-[5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanoyl]benzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)CCCCN1C(=O)CSC1=S |
| InChI | InChI=1S/C16H18ClN3O4S2/c1-24-12-6-5-10(17)8-11(12)15(23)19-18-13(21)4-2-3-7-20-14(22)9-26-16(20)25/h5-6,8H,2-4,7,9H2,1H3,(H,18,21)(H,19,23) |
| InChIKey | AFKPFVVSGKKVNF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|