C16H18FN3O3S2 — CID 9340752
4-fluoro-N'-[6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanoyl]benzohydrazide (PubChem CID 9340752) has the molecular formula C16H18FN3O3S2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-fluoro-N'-[6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanoyl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9340752 |
| Molecular Formula | C16H18FN3O3S2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 4-fluoro-N'-[6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanoyl]benzohydrazide |
| SMILES | O=C(CCCCCN1C(=O)CSC1=S)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FN3O3S2/c17-12-7-5-11(6-8-12)15(23)19-18-13(21)4-2-1-3-9-20-14(22)10-25-16(20)24/h5-8H,1-4,9-10H2,(H,18,21)(H,19,23) |
| InChIKey | NRLMSHWQXGZDNX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|