C17H20FN3O4S2 — CID 9471930
N'-[2-(2-fluorophenoxy)acetyl]-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanehydrazide (PubChem CID 9471930) has the molecular formula C17H20FN3O4S2 and a molecular weight of 413.50 g/mol. Its IUPAC name is N'-[2-(2-fluorophenoxy)acetyl]-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanehydrazide.
| Compound Name | N'-[2-(2-fluorophenoxy)acetyl]-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanehydrazide |
|---|---|
| PubChem CID | 9471930 |
| Molecular Formula | C17H20FN3O4S2 |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N'-[2-(2-fluorophenoxy)acetyl]-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanehydrazide |
| SMILES | O=C(CCCCCN1C(=O)CSC1=S)NNC(=O)COc1ccccc1F |
| InChI | InChI=1S/C17H20FN3O4S2/c18-12-6-3-4-7-13(12)25-10-15(23)20-19-14(22)8-2-1-5-9-21-16(24)11-27-17(21)26/h3-4,6-7H,1-2,5,8-11H2,(H,19,22)(H,20,23) |
| InChIKey | JFZJBEOPHPIBLQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|