C16H18Cl2N2O2S2 — CID 9218180
N-[(2,4-dichlorophenyl)methyl]-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanamide (PubChem CID 9218180) has the molecular formula C16H18Cl2N2O2S2 and a molecular weight of 405.37 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanamide |
|---|---|
| PubChem CID | 9218180 |
| Molecular Formula | C16H18Cl2N2O2S2 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)CSC1=S)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O2S2/c17-12-6-5-11(13(18)8-12)9-19-14(21)4-2-1-3-7-20-15(22)10-24-16(20)23/h5-6,8H,1-4,7,9-10H2,(H,19,21) |
| InChIKey | JSWBNXOYMSXBIU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|