C19H24N4O3S2 — CID 9159820
N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanehydrazide (PubChem CID 9159820) has the molecular formula C19H24N4O3S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanehydrazide.
| Compound Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanehydrazide |
|---|---|
| PubChem CID | 9159820 |
| Molecular Formula | C19H24N4O3S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanehydrazide |
| SMILES | O=C(CCCCN1C(=O)CSC1=S)NNC(=O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C19H24N4O3S2/c24-16(9-3-4-11-23-18(26)13-28-19(23)27)20-21-17(25)12-22-10-5-7-14-6-1-2-8-15(14)22/h1-2,6,8H,3-5,7,9-13H2,(H,20,24)(H,21,25) |
| InChIKey | KFFWENXGIWSSGZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|