C19H18ClN3O5 — CID 18595746
5-chloro-N'-[2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetyl]-2-methoxybenzohydrazide (PubChem CID 18595746) has the molecular formula C19H18ClN3O5 and a molecular weight of 403.82 g/mol. Its IUPAC name is 5-chloro-N'-[2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetyl]-2-methoxybenzohydrazide.
| Compound Name | 5-chloro-N'-[2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetyl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 18595746 |
| Molecular Formula | C19H18ClN3O5 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 5-chloro-N'-[2-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetyl]-2-methoxybenzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)CN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C19H18ClN3O5/c1-28-13-5-4-11(20)7-12(13)17(25)22-21-14(24)8-23-18(26)15-9-2-3-10(6-9)16(15)19(23)27/h2-5,7,9-10,15-16H,6,8H2,1H3,(H,21,24)(H,22,25)/t9-,10-,15-,16+/m0/s1 |
| InChIKey | MUKJXNHPBSFFRW-VUKUWZNJSA-N |
| XLogP | 0.92 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|