C17H16Cl2N2O3 — CID 36915541
5-chloro-N'-[3-(2-chlorophenyl)propanoyl]-2-methoxybenzohydrazide (PubChem CID 36915541) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is 5-chloro-N'-[3-(2-chlorophenyl)propanoyl]-2-methoxybenzohydrazide.
| Compound Name | 5-chloro-N'-[3-(2-chlorophenyl)propanoyl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 36915541 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 5-chloro-N'-[3-(2-chlorophenyl)propanoyl]-2-methoxybenzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O3/c1-24-15-8-7-12(18)10-13(15)17(23)21-20-16(22)9-6-11-4-2-3-5-14(11)19/h2-5,7-8,10H,6,9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | CQOBONBBFYDTSG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|