C17H14Cl2N2O3 — CID 24636069
5-chloro-N'-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-2-methoxybenzohydrazide (PubChem CID 24636069) has the molecular formula C17H14Cl2N2O3 and a molecular weight of 365.22 g/mol. Its IUPAC name is 5-chloro-N'-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-2-methoxybenzohydrazide.
| Compound Name | 5-chloro-N'-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 24636069 |
| Molecular Formula | C17H14Cl2N2O3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 5-chloro-N'-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-2-methoxybenzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C17H14Cl2N2O3/c1-24-15-8-7-12(18)10-13(15)17(23)21-20-16(22)9-6-11-4-2-3-5-14(11)19/h2-10H,1H3,(H,20,22)(H,21,23)/b9-6+ |
| InChIKey | ZJSVOPIUPULWNT-RMKNXTFCSA-N |
| XLogP | 3.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|