C17H13Cl3N2O3 — CID 9472211
5-chloro-N'-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-2-methoxybenzohydrazide (PubChem CID 9472211) has the molecular formula C17H13Cl3N2O3 and a molecular weight of 399.66 g/mol. Its IUPAC name is 5-chloro-N'-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-2-methoxybenzohydrazide.
| Compound Name | 5-chloro-N'-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 9472211 |
| Molecular Formula | C17H13Cl3N2O3 |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 5-chloro-N'-[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]-2-methoxybenzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)/C=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H13Cl3N2O3/c1-25-14-7-6-11(18)9-12(14)17(24)22-21-15(23)8-5-10-3-2-4-13(19)16(10)20/h2-9H,1H3,(H,21,23)(H,22,24)/b8-5+ |
| InChIKey | FDSVOXXONZCJDQ-VMPITWQZSA-N |
| XLogP | 4.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|