C22H23N3O5 — CID 9425397
(2R)-2-(2,3-dimethylphenoxy)-N'-[2-(1,3-dioxo-4H-isoquinolin-2-yl)acetyl]propanehydrazide (PubChem CID 9425397) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is (2R)-2-(2,3-dimethylphenoxy)-N'-[2-(1,3-dioxo-4H-isoquinolin-2-yl)acetyl]propanehydrazide.
| Compound Name | (2R)-2-(2,3-dimethylphenoxy)-N'-[2-(1,3-dioxo-4H-isoquinolin-2-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 9425397 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (2R)-2-(2,3-dimethylphenoxy)-N'-[2-(1,3-dioxo-4H-isoquinolin-2-yl)acetyl]propanehydrazide |
| SMILES | Cc1cccc(O[C@H](C)C(=O)NNC(=O)CN2C(=O)Cc3ccccc3C2=O)c1C |
| InChI | InChI=1S/C22H23N3O5/c1-13-7-6-10-18(14(13)2)30-15(3)21(28)24-23-19(26)12-25-20(27)11-16-8-4-5-9-17(16)22(25)29/h4-10,15H,11-12H2,1-3H3,(H,23,26)(H,24,28)/t15-/m1/s1 |
| InChIKey | SMSHNHNTTJLGIP-OAHLLOKOSA-N |
| XLogP | 1.44 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|