C17H14N2O6 — CID 17359001
3-[5-[(2-methylfuran-3-carbonyl)amino]-1,3-dioxoisoindol-2-yl]propanoic acid (PubChem CID 17359001) has the molecular formula C17H14N2O6 and a molecular weight of 342.31 g/mol. Its IUPAC name is 3-[5-[(2-methylfuran-3-carbonyl)amino]-1,3-dioxoisoindol-2-yl]propanoic acid.
| Compound Name | 3-[5-[(2-methylfuran-3-carbonyl)amino]-1,3-dioxoisoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 17359001 |
| Molecular Formula | C17H14N2O6 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 3-[5-[(2-methylfuran-3-carbonyl)amino]-1,3-dioxoisoindol-2-yl]propanoic acid |
| SMILES | Cc1occc1C(=O)Nc1ccc2c(c1)C(=O)N(CCC(=O)O)C2=O |
| InChI | InChI=1S/C17H14N2O6/c1-9-11(5-7-25-9)15(22)18-10-2-3-12-13(8-10)17(24)19(16(12)23)6-4-14(20)21/h2-3,5,7-8H,4,6H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | UBUXGXKWOVDERH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|