C19H15FN2O6 — CID 17360285
3-[5-[[2-(4-fluorophenoxy)acetyl]amino]-1,3-dioxoisoindol-2-yl]propanoic acid (PubChem CID 17360285) has the molecular formula C19H15FN2O6 and a molecular weight of 386.34 g/mol. Its IUPAC name is 3-[5-[[2-(4-fluorophenoxy)acetyl]amino]-1,3-dioxoisoindol-2-yl]propanoic acid.
| Compound Name | 3-[5-[[2-(4-fluorophenoxy)acetyl]amino]-1,3-dioxoisoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 17360285 |
| Molecular Formula | C19H15FN2O6 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 3-[5-[[2-(4-fluorophenoxy)acetyl]amino]-1,3-dioxoisoindol-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)c2ccc(NC(=O)COc3ccc(F)cc3)cc2C1=O |
| InChI | InChI=1S/C19H15FN2O6/c20-11-1-4-13(5-2-11)28-10-16(23)21-12-3-6-14-15(9-12)19(27)22(18(14)26)8-7-17(24)25/h1-6,9H,7-8,10H2,(H,21,23)(H,24,25) |
| InChIKey | RZBPWDSIKNEDOP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|