C21H21N3O5 — CID 9327673
N'-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoyl]-4-ethoxybenzohydrazide (PubChem CID 9327673) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is N'-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoyl]-4-ethoxybenzohydrazide.
| Compound Name | N'-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoyl]-4-ethoxybenzohydrazide |
|---|---|
| PubChem CID | 9327673 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N'-[3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoyl]-4-ethoxybenzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)CCN2C(=O)Cc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H21N3O5/c1-2-29-16-9-7-14(8-10-16)20(27)23-22-18(25)11-12-24-19(26)13-15-5-3-4-6-17(15)21(24)28/h3-10H,2,11-13H2,1H3,(H,22,25)(H,23,27) |
| InChIKey | DARDSGKAQKZPTP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|