C26H21F2N7O2S2 — CID 71536477
1-[(E)-[(1E)-4-(1,3-dioxoisoindol-2-yl)-1-[(4-fluorophenyl)carbamothioylhydrazinylidene]butan-2-ylidene]amino]-3-(4-fluorophenyl)thiourea (PubChem CID 71536477) has the molecular formula C26H21F2N7O2S2 and a molecular weight of 565.63 g/mol. Its IUPAC name is 1-[(E)-[(1E)-4-(1,3-dioxoisoindol-2-yl)-1-[(4-fluorophenyl)carbamothioylhydrazinylidene]butan-2-ylidene]amino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(E)-[(1E)-4-(1,3-dioxoisoindol-2-yl)-1-[(4-fluorophenyl)carbamothioylhydrazinylidene]butan-2-ylidene]amino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 71536477 |
| Molecular Formula | C26H21F2N7O2S2 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 1-[(E)-[(1E)-4-(1,3-dioxoisoindol-2-yl)-1-[(4-fluorophenyl)carbamothioylhydrazinylidene]butan-2-ylidene]amino]-3-(4-fluorophenyl)thiourea |
| SMILES | O=C1c2ccccc2C(=O)N1CCC(/C=N/NC(=S)Nc1ccc(F)cc1)=N\NC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H21F2N7O2S2/c27-16-5-9-18(10-6-16)30-25(38)33-29-15-20(32-34-26(39)31-19-11-7-17(28)8-12-19)13-14-35-23(36)21-3-1-2-4-22(21)24(35)37/h1-12,15H,13-14H2,(H2,30,33,38)(H2,31,34,39)/b29-15+,32-20+ |
| InChIKey | VILVSQOKKXCPMK-ZIWQWXAJSA-N |
| XLogP | 4.27 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|