C26H23F2N7O2S2 — CID 25159679
1-[(E)-[(1Z)-3-(1,3-dioxo-3a,7a-dihydroisoindol-2-yl)-1-[(4-fluorophenyl)carbamothioylhydrazinylidene]butan-2-ylidene]amino]-3-(4-fluorophenyl)thiourea (PubChem CID 25159679) has the molecular formula C26H23F2N7O2S2 and a molecular weight of 567.65 g/mol. Its IUPAC name is 1-[(E)-[(1Z)-3-(1,3-dioxo-3a,7a-dihydroisoindol-2-yl)-1-[(4-fluorophenyl)carbamothioylhydrazinylidene]butan-2-ylidene]amino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(E)-[(1Z)-3-(1,3-dioxo-3a,7a-dihydroisoindol-2-yl)-1-[(4-fluorophenyl)carbamothioylhydrazinylidene]butan-2-ylidene]amino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 25159679 |
| Molecular Formula | C26H23F2N7O2S2 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | 1-[(E)-[(1Z)-3-(1,3-dioxo-3a,7a-dihydroisoindol-2-yl)-1-[(4-fluorophenyl)carbamothioylhydrazinylidene]butan-2-ylidene]amino]-3-(4-fluorophenyl)thiourea |
| SMILES | CC(C(/C=N\NC(=S)Nc1ccc(F)cc1)=N\NC(=S)Nc1ccc(F)cc1)N1C(=O)C2C=CC=CC2C1=O |
| InChI | InChI=1S/C26H23F2N7O2S2/c1-15(35-23(36)20-4-2-3-5-21(20)24(35)37)22(32-34-26(39)31-19-12-8-17(28)9-13-19)14-29-33-25(38)30-18-10-6-16(27)7-11-18/h2-15,20-21H,1H3,(H2,30,33,38)(H2,31,34,39)/b29-14-,32-22- |
| InChIKey | NSDQRUATGGWGEV-NZGSVPABSA-N |
| XLogP | 3.70 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|