C28H27N7O4S2 — CID 46177122
1-[(E)-[(1E)-3-(1,3-dioxoisoindol-2-yl)-1-[(4-methoxyphenyl)carbamothioylhydrazinylidene]butan-2-ylidene]amino]-3-(4-methoxyphenyl)thiourea (PubChem CID 46177122) has the molecular formula C28H27N7O4S2 and a molecular weight of 589.70 g/mol. Its IUPAC name is 1-[(E)-[(1E)-3-(1,3-dioxoisoindol-2-yl)-1-[(4-methoxyphenyl)carbamothioylhydrazinylidene]butan-2-ylidene]amino]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[(E)-[(1E)-3-(1,3-dioxoisoindol-2-yl)-1-[(4-methoxyphenyl)carbamothioylhydrazinylidene]butan-2-ylidene]amino]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 46177122 |
| Molecular Formula | C28H27N7O4S2 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | 1-[(E)-[(1E)-3-(1,3-dioxoisoindol-2-yl)-1-[(4-methoxyphenyl)carbamothioylhydrazinylidene]butan-2-ylidene]amino]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N/N=C/C(=N/NC(=S)Nc2ccc(OC)cc2)C(C)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C28H27N7O4S2/c1-17(35-25(36)22-6-4-5-7-23(22)26(35)37)24(32-34-28(41)31-19-10-14-21(39-3)15-11-19)16-29-33-27(40)30-18-8-12-20(38-2)13-9-18/h4-17H,1-3H3,(H2,30,33,40)(H2,31,34,41)/b29-16+,32-24- |
| InChIKey | JRXVXHOAUQRYSO-DBSOFCDOSA-N |
| XLogP | 4.00 |
| TPSA | 128.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|