C33H30N6O5S2 — CID 6832033
methyl 4-[[[2-[(4-methoxycarbonylphenyl)carbamothioylhydrazinylidene]-2-(4-methoxyphenyl)-1-phenylethylidene]amino]carbamothioylamino]benzoate (PubChem CID 6832033) has the molecular formula C33H30N6O5S2 and a molecular weight of 654.77 g/mol. Its IUPAC name is methyl 4-[[[2-[(4-methoxycarbonylphenyl)carbamothioylhydrazinylidene]-2-(4-methoxyphenyl)-1-phenylethylidene]amino]carbamothioylamino]benzoate.
| Compound Name | methyl 4-[[[2-[(4-methoxycarbonylphenyl)carbamothioylhydrazinylidene]-2-(4-methoxyphenyl)-1-phenylethylidene]amino]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 6832033 |
| Molecular Formula | C33H30N6O5S2 |
| Molecular Weight | 654.77 g/mol |
| Exact Mass | 654.17 |
| IUPAC Name | methyl 4-[[[2-[(4-methoxycarbonylphenyl)carbamothioylhydrazinylidene]-2-(4-methoxyphenyl)-1-phenylethylidene]amino]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)NN=C(C(=NNC(=S)Nc2ccc(C(=O)OC)cc2)c2ccc(OC)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H30N6O5S2/c1-42-27-19-13-22(14-20-27)29(37-39-33(46)35-26-17-11-24(12-18-26)31(41)44-3)28(21-7-5-4-6-8-21)36-38-32(45)34-25-15-9-23(10-16-25)30(40)43-2/h4-20H,1-3H3,(H2,34,38,45)(H2,35,39,46) |
| InChIKey | VTXDBVLTMRQIFT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 134.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.77 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|