C23H23N5O2S — CID 3710651
1-[1-[4-[(4-methoxyphenyl)carbamothioylamino]phenyl]ethylideneamino]-3-phenylurea (PubChem CID 3710651) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 1-[1-[4-[(4-methoxyphenyl)carbamothioylamino]phenyl]ethylideneamino]-3-phenylurea.
| Compound Name | 1-[1-[4-[(4-methoxyphenyl)carbamothioylamino]phenyl]ethylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 3710651 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-[1-[4-[(4-methoxyphenyl)carbamothioylamino]phenyl]ethylideneamino]-3-phenylurea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(C(C)=NNC(=O)Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H23N5O2S/c1-16(27-28-22(29)24-18-6-4-3-5-7-18)17-8-10-19(11-9-17)25-23(31)26-20-12-14-21(30-2)15-13-20/h3-15H,1-2H3,(H2,24,28,29)(H2,25,26,31) |
| InChIKey | ZSMHSNBKVYDRGH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|