C24H25N5O2S — CID 177439250
1-[(E)-1-[4-[(4-methoxyphenyl)carbamothioylamino]phenyl]ethylideneamino]-3-(4-methylphenyl)urea (PubChem CID 177439250) has the molecular formula C24H25N5O2S and a molecular weight of 447.56 g/mol. Its IUPAC name is 1-[(E)-1-[4-[(4-methoxyphenyl)carbamothioylamino]phenyl]ethylideneamino]-3-(4-methylphenyl)urea.
| Compound Name | 1-[(E)-1-[4-[(4-methoxyphenyl)carbamothioylamino]phenyl]ethylideneamino]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 177439250 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 1-[(E)-1-[4-[(4-methoxyphenyl)carbamothioylamino]phenyl]ethylideneamino]-3-(4-methylphenyl)urea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(/C(C)=N/NC(=O)Nc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H25N5O2S/c1-16-4-8-19(9-5-16)25-23(30)29-28-17(2)18-6-10-20(11-7-18)26-24(32)27-21-12-14-22(31-3)15-13-21/h4-15H,1-3H3,(H2,25,29,30)(H2,26,27,32)/b28-17+ |
| InChIKey | CMGVHWAOZJEQJJ-OGLMXYFKSA-N |
| XLogP | 5.36 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|