C15H14N2OS2 — CID 12778974
4-methoxy-N-(phenylcarbamothioyl)benzenecarbothioamide (PubChem CID 12778974) has the molecular formula C15H14N2OS2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-methoxy-N-(phenylcarbamothioyl)benzenecarbothioamide.
| Compound Name | 4-methoxy-N-(phenylcarbamothioyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 12778974 |
| Molecular Formula | C15H14N2OS2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 4-methoxy-N-(phenylcarbamothioyl)benzenecarbothioamide |
| SMILES | COc1ccc(C(=S)NC(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C15H14N2OS2/c1-18-13-9-7-11(8-10-13)14(19)17-15(20)16-12-5-3-2-4-6-12/h2-10H,1H3,(H2,16,17,19,20) |
| InChIKey | DSXWQXSABPVMQE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|