C23H24N3OS+ — CID 6347354
benzyl-[[(4-methoxyphenyl)carbamothioylamino]-(4-methylphenyl)methylidene]azanium (PubChem CID 6347354) has the molecular formula C23H24N3OS+ and a molecular weight of 390.53 g/mol. Its IUPAC name is benzyl-[[(4-methoxyphenyl)carbamothioylamino]-(4-methylphenyl)methylidene]azanium.
| Compound Name | benzyl-[[(4-methoxyphenyl)carbamothioylamino]-(4-methylphenyl)methylidene]azanium |
|---|---|
| PubChem CID | 6347354 |
| Molecular Formula | C23H24N3OS+ |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | benzyl-[[(4-methoxyphenyl)carbamothioylamino]-(4-methylphenyl)methylidene]azanium |
| SMILES | COc1ccc(NC(=S)N/C(=[NH+]\Cc2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H23N3OS/c1-17-8-10-19(11-9-17)22(24-16-18-6-4-3-5-7-18)26-23(28)25-20-12-14-21(27-2)15-13-20/h3-15H,16H2,1-2H3,(H2,24,25,26,28)/p+1 |
| InChIKey | RNTYCLBNANVKSE-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|