C24H24N3O4S2+ — CID 2134316
benzenesulfonylmethyl-[[(4-methoxycarbonylphenyl)carbamothioylamino]-(4-methylphenyl)methylidene]azanium (PubChem CID 2134316) has the molecular formula C24H24N3O4S2+ and a molecular weight of 482.61 g/mol. Its IUPAC name is benzenesulfonylmethyl-[[(4-methoxycarbonylphenyl)carbamothioylamino]-(4-methylphenyl)methylidene]azanium.
| Compound Name | benzenesulfonylmethyl-[[(4-methoxycarbonylphenyl)carbamothioylamino]-(4-methylphenyl)methylidene]azanium |
|---|---|
| PubChem CID | 2134316 |
| Molecular Formula | C24H24N3O4S2+ |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | benzenesulfonylmethyl-[[(4-methoxycarbonylphenyl)carbamothioylamino]-(4-methylphenyl)methylidene]azanium |
| SMILES | COC(=O)c1ccc(NC(=S)NC(=[NH+]CS(=O)(=O)c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O4S2/c1-17-8-10-18(11-9-17)22(25-16-33(29,30)21-6-4-3-5-7-21)27-24(32)26-20-14-12-19(13-15-20)23(28)31-2/h3-15H,16H2,1-2H3,(H2,25,26,27,32)/p+1 |
| InChIKey | KRDBIWNSGPOWKS-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|