C22H23N3O4 — CID 122178482
(2S,3S)-2-(1,3-dioxoisoindol-2-yl)-N-[(Z)-(4-methoxyphenyl)methylideneamino]-3-methylpentanamide (PubChem CID 122178482) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-N-[(Z)-(4-methoxyphenyl)methylideneamino]-3-methylpentanamide.
| Compound Name | (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-N-[(Z)-(4-methoxyphenyl)methylideneamino]-3-methylpentanamide |
|---|---|
| PubChem CID | 122178482 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-N-[(Z)-(4-methoxyphenyl)methylideneamino]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@@H](C(=O)N/N=C\c1ccc(OC)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H23N3O4/c1-4-14(2)19(25-21(27)17-7-5-6-8-18(17)22(25)28)20(26)24-23-13-15-9-11-16(29-3)12-10-15/h5-14,19H,4H2,1-3H3,(H,24,26)/b23-13-/t14-,19-/m0/s1 |
| InChIKey | XVDCOFCLFCQJSB-WLHPTWJISA-N |
| XLogP | 2.86 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|