C25H24N2O5 — CID 20535251
[2-(4-methylbenzoyl)oxy-5-[2-(propan-2-ylamino)acetyl]phenyl] pyridine-2-carboxylate (PubChem CID 20535251) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is [2-(4-methylbenzoyl)oxy-5-[2-(propan-2-ylamino)acetyl]phenyl] pyridine-2-carboxylate.
| Compound Name | [2-(4-methylbenzoyl)oxy-5-[2-(propan-2-ylamino)acetyl]phenyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 20535251 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [2-(4-methylbenzoyl)oxy-5-[2-(propan-2-ylamino)acetyl]phenyl] pyridine-2-carboxylate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(=O)CNC(C)C)cc2OC(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C25H24N2O5/c1-16(2)27-15-21(28)19-11-12-22(31-24(29)18-9-7-17(3)8-10-18)23(14-19)32-25(30)20-6-4-5-13-26-20/h4-14,16,27H,15H2,1-3H3 |
| InChIKey | QULYLTGXGIQJBP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|