C24H36O9 — CID 139260612
[2,3-bis(2,2-dimethylpropanoyloxy)-5-[(1S,2S)-1,2,3-trihydroxypropyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 139260612) has the molecular formula C24H36O9 and a molecular weight of 468.54 g/mol. Its IUPAC name is [2,3-bis(2,2-dimethylpropanoyloxy)-5-[(1S,2S)-1,2,3-trihydroxypropyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [2,3-bis(2,2-dimethylpropanoyloxy)-5-[(1S,2S)-1,2,3-trihydroxypropyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139260612 |
| Molecular Formula | C24H36O9 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | [2,3-bis(2,2-dimethylpropanoyloxy)-5-[(1S,2S)-1,2,3-trihydroxypropyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1cc([C@H](O)[C@@H](O)CO)cc(OC(=O)C(C)(C)C)c1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C24H36O9/c1-22(2,3)19(28)31-15-10-13(17(27)14(26)12-25)11-16(32-20(29)23(4,5)6)18(15)33-21(30)24(7,8)9/h10-11,14,17,25-27H,12H2,1-9H3/t14-,17-/m0/s1 |
| InChIKey | IXVFVXDJDHKDLL-YOEHRIQHSA-N |
| XLogP | 2.93 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|