C23H32O8 — CID 139260607
methyl 3,4,5-tris(2,2-dimethylpropanoyloxy)benzoate (PubChem CID 139260607) has the molecular formula C23H32O8 and a molecular weight of 436.50 g/mol. Its IUPAC name is methyl 3,4,5-tris(2,2-dimethylpropanoyloxy)benzoate.
| Compound Name | methyl 3,4,5-tris(2,2-dimethylpropanoyloxy)benzoate |
|---|---|
| PubChem CID | 139260607 |
| Molecular Formula | C23H32O8 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | methyl 3,4,5-tris(2,2-dimethylpropanoyloxy)benzoate |
| SMILES | COC(=O)c1cc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C23H32O8/c1-21(2,3)18(25)29-14-11-13(17(24)28-10)12-15(30-19(26)22(4,5)6)16(14)31-20(27)23(7,8)9/h11-12H,1-10H3 |
| InChIKey | JSTBULRKMBVTTN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|