C19H21Br3O8 — CID 71406625
3,4,5-tris[(2-bromo-2-methylpropanoyl)oxy]benzoic acid (PubChem CID 71406625) has the molecular formula C19H21Br3O8 and a molecular weight of 617.08 g/mol. Its IUPAC name is 3,4,5-tris[(2-bromo-2-methylpropanoyl)oxy]benzoic acid.
| Compound Name | 3,4,5-tris[(2-bromo-2-methylpropanoyl)oxy]benzoic acid |
|---|---|
| PubChem CID | 71406625 |
| Molecular Formula | C19H21Br3O8 |
| Molecular Weight | 617.08 g/mol |
| Exact Mass | 613.88 |
| IUPAC Name | 3,4,5-tris[(2-bromo-2-methylpropanoyl)oxy]benzoic acid |
| SMILES | CC(C)(Br)C(=O)Oc1cc(C(=O)O)cc(OC(=O)C(C)(C)Br)c1OC(=O)C(C)(C)Br |
| InChI | InChI=1S/C19H21Br3O8/c1-17(2,20)14(25)28-10-7-9(13(23)24)8-11(29-15(26)18(3,4)21)12(10)30-16(27)19(5,6)22/h7-8H,1-6H3,(H,23,24) |
| InChIKey | NVUXBLGDQDGXEK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.08 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|