C12H15NO8 — CID 166722013
4-[(1R)-2-amino-1-(3,4-dihydroxyphenyl)ethoxy]-2,3-dihydroxy-4-oxobutanoic acid (PubChem CID 166722013) has the molecular formula C12H15NO8 and a molecular weight of 301.25 g/mol. Its IUPAC name is 4-[(1R)-2-amino-1-(3,4-dihydroxyphenyl)ethoxy]-2,3-dihydroxy-4-oxobutanoic acid.
| Compound Name | 4-[(1R)-2-amino-1-(3,4-dihydroxyphenyl)ethoxy]-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 166722013 |
| Molecular Formula | C12H15NO8 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-[(1R)-2-amino-1-(3,4-dihydroxyphenyl)ethoxy]-2,3-dihydroxy-4-oxobutanoic acid |
| SMILES | NC[C@H](OC(=O)C(O)C(O)C(=O)O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H15NO8/c13-4-8(5-1-2-6(14)7(15)3-5)21-12(20)10(17)9(16)11(18)19/h1-3,8-10,14-17H,4,13H2,(H,18,19)/t8-,9?,10?/m0/s1 |
| InChIKey | OGLDSCXVUGFPFV-IDKOKCKLSA-N |
| XLogP | -1.55 |
| TPSA | 170.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|