C12H15NO9-2 — CID 154731044
4-[(1S)-2-amino-1-hydroxyethyl]benzene-1,2-diol;(2R,3R)-2,3-dihydroxybutanedioate (PubChem CID 154731044) has the molecular formula C12H15NO9-2 and a molecular weight of 317.25 g/mol. Its IUPAC name is 4-[(1S)-2-amino-1-hydroxyethyl]benzene-1,2-diol;(2R,3R)-2,3-dihydroxybutanedioate.
| Compound Name | 4-[(1S)-2-amino-1-hydroxyethyl]benzene-1,2-diol;(2R,3R)-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 154731044 |
| Molecular Formula | C12H15NO9-2 |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 4-[(1S)-2-amino-1-hydroxyethyl]benzene-1,2-diol;(2R,3R)-2,3-dihydroxybutanedioate |
| SMILES | NC[C@@H](O)c1ccc(O)c(O)c1.O=C([O-])[C@H](O)[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C8H11NO3.C4H6O6/c9-4-8(12)5-1-2-6(10)7(11)3-5;5-1(3(7)8)2(6)4(9)10/h1-3,8,10-12H,4,9H2;1-2,5-6H,(H,7,8)(H,9,10)/p-2/t8-;1-,2-/m11/s1 |
| InChIKey | WNPNNLQNNJQYFA-HQWYAZORSA-L |
| XLogP | -4.70 |
| TPSA | 207.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|