C12H19NO10 — CID 517292
[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium;2,3,4-trihydroxy-4-oxobutanoate;hydrate (PubChem CID 517292) has the molecular formula C12H19NO10 and a molecular weight of 337.28 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium;2,3,4-trihydroxy-4-oxobutanoate;hydrate.
| Compound Name | [2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium;2,3,4-trihydroxy-4-oxobutanoate;hydrate |
|---|---|
| PubChem CID | 517292 |
| Molecular Formula | C12H19NO10 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium;2,3,4-trihydroxy-4-oxobutanoate;hydrate |
| SMILES | O.O=C([O-])C(O)C(O)C(=O)O.[NH3+]CC(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO3.C4H6O6.H2O/c9-4-8(12)5-1-2-6(10)7(11)3-5;5-1(3(7)8)2(6)4(9)10;/h1-3,8,10-12H,4,9H2;1-2,5-6H,(H,7,8)(H,9,10);1H2 |
| InChIKey | LNBCGLZYLJMGKP-UHFFFAOYSA-N |
| XLogP | -4.91 |
| TPSA | 237.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|