C8H9FO3 — CID 130033907
4-(2-fluoro-1-hydroxyethyl)benzene-1,2-diol (PubChem CID 130033907) has the molecular formula C8H9FO3 and a molecular weight of 172.15 g/mol. Its IUPAC name is 4-(2-fluoro-1-hydroxyethyl)benzene-1,2-diol.
| Compound Name | 4-(2-fluoro-1-hydroxyethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 130033907 |
| Molecular Formula | C8H9FO3 |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 4-(2-fluoro-1-hydroxyethyl)benzene-1,2-diol |
| SMILES | Oc1ccc(C(O)CF)cc1O |
| InChI | InChI=1S/C8H9FO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4H2 |
| InChIKey | ZMSUBNGIERJQTF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|