C12H13NO5 — CID 142609413
1-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]pyrrolidine-2,5-dione (PubChem CID 142609413) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is 1-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 142609413 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CC(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H13NO5/c14-8-2-1-7(5-9(8)15)10(16)6-13-11(17)3-4-12(13)18/h1-2,5,10,14-16H,3-4,6H2 |
| InChIKey | AJAQMPUKDUQDQY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|