C18H22N2O4 — CID 176946490
4-[1-hydroxy-2-[4-(2-hydroxyphenyl)piperazin-1-yl]ethyl]benzene-1,2-diol (PubChem CID 176946490) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-[1-hydroxy-2-[4-(2-hydroxyphenyl)piperazin-1-yl]ethyl]benzene-1,2-diol.
| Compound Name | 4-[1-hydroxy-2-[4-(2-hydroxyphenyl)piperazin-1-yl]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 176946490 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[1-hydroxy-2-[4-(2-hydroxyphenyl)piperazin-1-yl]ethyl]benzene-1,2-diol |
| SMILES | Oc1ccc(C(O)CN2CCN(c3ccccc3O)CC2)cc1O |
| InChI | InChI=1S/C18H22N2O4/c21-15-4-2-1-3-14(15)20-9-7-19(8-10-20)12-18(24)13-5-6-16(22)17(23)11-13/h1-6,11,18,21-24H,7-10,12H2 |
| InChIKey | YSTMYGOLOAKMTP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|