C23H32N2O3 — CID 29404375
2-[4-[(2S)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]piperazin-1-yl]phenol (PubChem CID 29404375) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-[4-[(2S)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]piperazin-1-yl]phenol.
| Compound Name | 2-[4-[(2S)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 29404375 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 2-[4-[(2S)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]piperazin-1-yl]phenol |
| SMILES | CC(C)(C)c1ccc(OC[C@@H](O)CN2CCN(c3ccccc3O)CC2)cc1 |
| InChI | InChI=1S/C23H32N2O3/c1-23(2,3)18-8-10-20(11-9-18)28-17-19(26)16-24-12-14-25(15-13-24)21-6-4-5-7-22(21)27/h4-11,19,26-27H,12-17H2,1-3H3/t19-/m0/s1 |
| InChIKey | MAMHPCDYABBUEM-IBGZPJMESA-N |
| XLogP | 3.25 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |