C11H14O4 — CID 162869792
(3,5-dihydroxyphenyl) 2-methylbutanoate (PubChem CID 162869792) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (3,5-dihydroxyphenyl) 2-methylbutanoate.
| Compound Name | (3,5-dihydroxyphenyl) 2-methylbutanoate |
|---|---|
| PubChem CID | 162869792 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (3,5-dihydroxyphenyl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)Oc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H14O4/c1-3-7(2)11(14)15-10-5-8(12)4-9(13)6-10/h4-7,12-13H,3H2,1-2H3 |
| InChIKey | IDVZWPPENPYDCH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|