C11H13O5S- — CID 58391899
4-(2-methylbutanoyloxy)benzenesulfonate (PubChem CID 58391899) has the molecular formula C11H13O5S- and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-(2-methylbutanoyloxy)benzenesulfonate.
| Compound Name | 4-(2-methylbutanoyloxy)benzenesulfonate |
|---|---|
| PubChem CID | 58391899 |
| Molecular Formula | C11H13O5S- |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4-(2-methylbutanoyloxy)benzenesulfonate |
| SMILES | CCC(C)C(=O)Oc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C11H14O5S/c1-3-8(2)11(12)16-9-4-6-10(7-5-9)17(13,14)15/h4-8H,3H2,1-2H3,(H,13,14,15)/p-1 |
| InChIKey | YGSKBHXCZGGTBX-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|