C30H33F2O10S- — CID 123327853
4-butan-2-ylphenol;2-[2-[6-(2,2-dimethylbutanoyloxy)naphthalen-2-yl]oxy-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 123327853) has the molecular formula C30H33F2O10S- and a molecular weight of 623.65 g/mol. Its IUPAC name is 4-butan-2-ylphenol;2-[2-[6-(2,2-dimethylbutanoyloxy)naphthalen-2-yl]oxy-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 4-butan-2-ylphenol;2-[2-[6-(2,2-dimethylbutanoyloxy)naphthalen-2-yl]oxy-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 123327853 |
| Molecular Formula | C30H33F2O10S- |
| Molecular Weight | 623.65 g/mol |
| Exact Mass | 623.18 |
| IUPAC Name | 4-butan-2-ylphenol;2-[2-[6-(2,2-dimethylbutanoyloxy)naphthalen-2-yl]oxy-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc2cc(OC(=O)COC(=O)C(F)(F)S(=O)(=O)[O-])ccc2c1.CCC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H20F2O9S.C10H14O/c1-4-19(2,3)17(24)31-15-8-6-12-9-14(7-5-13(12)10-15)30-16(23)11-29-18(25)20(21,22)32(26,27)28;1-3-8(2)9-4-6-10(11)7-5-9/h5-10H,4,11H2,1-3H3,(H,26,27,28);4-8,11H,3H2,1-2H3/p-1 |
| InChIKey | AODMHKYPZMGVOG-UHFFFAOYSA-M |
| XLogP | 5.67 |
| TPSA | 156.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.65 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|