C29H41FO4 — CID 165021361
4-butan-2-ylphenol;[3-fluoro-4-(1-methylcyclohexyl)oxyphenyl] 2,2-dimethylbutanoate (PubChem CID 165021361) has the molecular formula C29H41FO4 and a molecular weight of 472.64 g/mol. Its IUPAC name is 4-butan-2-ylphenol;[3-fluoro-4-(1-methylcyclohexyl)oxyphenyl] 2,2-dimethylbutanoate.
| Compound Name | 4-butan-2-ylphenol;[3-fluoro-4-(1-methylcyclohexyl)oxyphenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 165021361 |
| Molecular Formula | C29H41FO4 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 4-butan-2-ylphenol;[3-fluoro-4-(1-methylcyclohexyl)oxyphenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(OC2(C)CCCCC2)c(F)c1.CCC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H27FO3.C10H14O/c1-5-18(2,3)17(21)22-14-9-10-16(15(20)13-14)23-19(4)11-7-6-8-12-19;1-3-8(2)9-4-6-10(11)7-5-9/h9-10,13H,5-8,11-12H2,1-4H3;4-8,11H,3H2,1-2H3 |
| InChIKey | LFADSSCDVFQGRY-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|