C15H17F5O6S — CID 58363960
2-[2-(4-butan-2-ylphenoxy)-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 58363960) has the molecular formula C15H17F5O6S and a molecular weight of 420.35 g/mol. Its IUPAC name is 2-[2-(4-butan-2-ylphenoxy)-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-[2-(4-butan-2-ylphenoxy)-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58363960 |
| Molecular Formula | C15H17F5O6S |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 2-[2-(4-butan-2-ylphenoxy)-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | CCC(C)c1ccc(OC(=O)COC(C(F)(F)F)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H17F5O6S/c1-3-9(2)10-4-6-11(7-5-10)26-12(21)8-25-13(14(16,17)18)15(19,20)27(22,23)24/h4-7,9,13H,3,8H2,1-2H3,(H,22,23,24) |
| InChIKey | IOZATWYSAXTNSX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|