C15H16F5O6S- — CID 59222745
2-[2-(4-butan-2-ylphenoxy)acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate (PubChem CID 59222745) has the molecular formula C15H16F5O6S- and a molecular weight of 419.34 g/mol. Its IUPAC name is 2-[2-(4-butan-2-ylphenoxy)acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate.
| Compound Name | 2-[2-(4-butan-2-ylphenoxy)acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 59222745 |
| Molecular Formula | C15H16F5O6S- |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2-[2-(4-butan-2-ylphenoxy)acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate |
| SMILES | CCC(C)c1ccc(OCC(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C15H17F5O6S/c1-3-9(2)10-4-6-11(7-5-10)25-8-12(21)26-13(14(16,17)18)15(19,20)27(22,23)24/h4-7,9,13H,3,8H2,1-2H3,(H,22,23,24)/p-1 |
| InChIKey | HVSRQMWSGLNWFL-UHFFFAOYSA-M |
| XLogP | 3.19 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|